C17H22N6 — CID 89322849
N-[(Z)-1-[3-(6-piperazin-1-ylpyrazin-2-yl)phenyl]ethylideneamino]methanamine (PubChem CID 89322849) has the molecular formula C17H22N6 and a molecular weight of 310.41 g/mol. Its IUPAC name is N-[(Z)-1-[3-(6-piperazin-1-ylpyrazin-2-yl)phenyl]ethylideneamino]methanamine.
| Compound Name | N-[(Z)-1-[3-(6-piperazin-1-ylpyrazin-2-yl)phenyl]ethylideneamino]methanamine |
|---|---|
| PubChem CID | 89322849 |
| Molecular Formula | C17H22N6 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | N-[(Z)-1-[3-(6-piperazin-1-ylpyrazin-2-yl)phenyl]ethylideneamino]methanamine |
| SMILES | CN/N=C(/C)c1cccc(-c2cncc(N3CCNCC3)n2)c1 |
| InChI | InChI=1S/C17H22N6/c1-13(22-18-2)14-4-3-5-15(10-14)16-11-20-12-17(21-16)23-8-6-19-7-9-23/h3-5,10-12,18-19H,6-9H2,1-2H3/b22-13- |
| InChIKey | KKUBQNHOINWBRC-XKZIYDEJSA-N |
| XLogP | 1.50 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|