C18H22N4O2 — CID 89325080
1-ethyl-3-[6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methoxy-1H-benzimidazol-2-yl]urea (PubChem CID 89325080) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-ethyl-3-[6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methoxy-1H-benzimidazol-2-yl]urea.
| Compound Name | 1-ethyl-3-[6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methoxy-1H-benzimidazol-2-yl]urea |
|---|---|
| PubChem CID | 89325080 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-ethyl-3-[6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methoxy-1H-benzimidazol-2-yl]urea |
| SMILES | C=C/C=C\C(=C/C)c1cc(OC)c2nc(NC(=O)NCC)[nH]c2c1 |
| InChI | InChI=1S/C18H22N4O2/c1-5-8-9-12(6-2)13-10-14-16(15(11-13)24-4)21-17(20-14)22-18(23)19-7-3/h5-6,8-11H,1,7H2,2-4H3,(H3,19,20,21,22,23)/b9-8-,12-6+ |
| InChIKey | JJUXYKNYJPPLDK-HQBPLYTQSA-N |
| XLogP | 3.86 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|