C16H36N2 — CID 89325605
(2S)-5-N-butyl-3,3,7,7-tetramethyloctane-2,5-diamine (PubChem CID 89325605) has the molecular formula C16H36N2 and a molecular weight of 256.48 g/mol. Its IUPAC name is (2S)-5-N-butyl-3,3,7,7-tetramethyloctane-2,5-diamine.
| Compound Name | (2S)-5-N-butyl-3,3,7,7-tetramethyloctane-2,5-diamine |
|---|---|
| PubChem CID | 89325605 |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.29 |
| IUPAC Name | (2S)-5-N-butyl-3,3,7,7-tetramethyloctane-2,5-diamine |
| SMILES | CCCCNC(CC(C)(C)C)CC(C)(C)[C@H](C)N |
| InChI | InChI=1S/C16H36N2/c1-8-9-10-18-14(11-15(3,4)5)12-16(6,7)13(2)17/h13-14,18H,8-12,17H2,1-7H3/t13-,14?/m0/s1 |
| InChIKey | CHWRESHFPRRVCG-LSLKUGRBSA-N |
| XLogP | 3.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|