C8H11F5N2O3 — CID 89328849
2-ethoxy-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide (PubChem CID 89328849) has the molecular formula C8H11F5N2O3 and a molecular weight of 278.18 g/mol. Its IUPAC name is 2-ethoxy-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide.
| Compound Name | 2-ethoxy-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
|---|---|
| PubChem CID | 89328849 |
| Molecular Formula | C8H11F5N2O3 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-ethoxy-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
| SMILES | CCOC(C(N)=O)C(=O)NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H11F5N2O3/c1-2-18-4(5(14)16)6(17)15-3-7(9,10)8(11,12)13/h4H,2-3H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | RBTFKQXHPRQZIO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|