C41H37N3S — CID 89333206
(2E)-2-(1,3-benzothiazol-2-yl)-2-[4,4-dimethyl-7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-3,4a,5,6-tetrahydronaphthalen-2-ylidene]acetonitrile (PubChem CID 89333206) has the molecular formula C41H37N3S and a molecular weight of 603.84 g/mol. Its IUPAC name is (2E)-2-(1,3-benzothiazol-2-yl)-2-[4,4-dimethyl-7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-3,4a,5,6-tetrahydronaphthalen-2-ylidene]acetonitrile.
| Compound Name | (2E)-2-(1,3-benzothiazol-2-yl)-2-[4,4-dimethyl-7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-3,4a,5,6-tetrahydronaphthalen-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 89333206 |
| Molecular Formula | C41H37N3S |
| Molecular Weight | 603.84 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | (2E)-2-(1,3-benzothiazol-2-yl)-2-[4,4-dimethyl-7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-3,4a,5,6-tetrahydronaphthalen-2-ylidene]acetonitrile |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(C3=CC4=C/C(=C(\C#N)c5nc6ccccc6s5)CC(C)(C)C4CC3)cc2)cc1 |
| InChI | InChI=1S/C41H37N3S/c1-27-9-16-33(17-10-27)44(34-18-11-28(2)12-19-34)35-20-13-29(14-21-35)30-15-22-37-31(23-30)24-32(25-41(37,3)4)36(26-42)40-43-38-7-5-6-8-39(38)45-40/h5-14,16-21,23-24,37H,15,22,25H2,1-4H3/b36-32- |
| InChIKey | JTAPYHUBKIWLLA-HIELXXDYSA-N |
| XLogP | 11.51 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.84 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|