C26H18N2OS — CID 4133106
2-(1,3-benzothiazol-2-yl)-2-[6-methyl-2-(4-methylphenyl)chromen-4-ylidene]acetonitrile (PubChem CID 4133106) has the molecular formula C26H18N2OS and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-2-[6-methyl-2-(4-methylphenyl)chromen-4-ylidene]acetonitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-2-[6-methyl-2-(4-methylphenyl)chromen-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 4133106 |
| Molecular Formula | C26H18N2OS |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-2-[6-methyl-2-(4-methylphenyl)chromen-4-ylidene]acetonitrile |
| SMILES | Cc1ccc(C2=CC(=C(C#N)c3nc4ccccc4s3)c3cc(C)ccc3O2)cc1 |
| InChI | InChI=1S/C26H18N2OS/c1-16-7-10-18(11-8-16)24-14-19(20-13-17(2)9-12-23(20)29-24)21(15-27)26-28-22-5-3-4-6-25(22)30-26/h3-14H,1-2H3 |
| InChIKey | GBBFGTCLFKXRGE-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|