C27H16N2O2S2 — CID 143123904
4-[(4E)-4-[1,3-benzothiazol-2-yl(cyano)methylidene]-6-phenylthiopyran-2-yl]benzoic acid (PubChem CID 143123904) has the molecular formula C27H16N2O2S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 4-[(4E)-4-[1,3-benzothiazol-2-yl(cyano)methylidene]-6-phenylthiopyran-2-yl]benzoic acid.
| Compound Name | 4-[(4E)-4-[1,3-benzothiazol-2-yl(cyano)methylidene]-6-phenylthiopyran-2-yl]benzoic acid |
|---|---|
| PubChem CID | 143123904 |
| Molecular Formula | C27H16N2O2S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 4-[(4E)-4-[1,3-benzothiazol-2-yl(cyano)methylidene]-6-phenylthiopyran-2-yl]benzoic acid |
| SMILES | N#C/C(=C1/C=C(c2ccccc2)SC(c2ccc(C(=O)O)cc2)=C1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C27H16N2O2S2/c28-16-21(26-29-22-8-4-5-9-23(22)33-26)20-14-24(17-6-2-1-3-7-17)32-25(15-20)18-10-12-19(13-11-18)27(30)31/h1-15H,(H,30,31)/b21-20+ |
| InChIKey | SCTWLDNQJGEDJC-QZQOTICOSA-N |
| XLogP | 7.10 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|