C22H25NO4 — CID 89333309
methyl 2-(2-ethoxyhexa-1,3,4-trien-3-yl)-1-[(4-methoxyphenyl)methyl]pyrrole-3-carboxylate (PubChem CID 89333309) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl 2-(2-ethoxyhexa-1,3,4-trien-3-yl)-1-[(4-methoxyphenyl)methyl]pyrrole-3-carboxylate.
| Compound Name | methyl 2-(2-ethoxyhexa-1,3,4-trien-3-yl)-1-[(4-methoxyphenyl)methyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 89333309 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | methyl 2-(2-ethoxyhexa-1,3,4-trien-3-yl)-1-[(4-methoxyphenyl)methyl]pyrrole-3-carboxylate |
| SMILES | C=C(OCC)C(=C=CC)c1c(C(=O)OC)ccn1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H25NO4/c1-6-8-19(16(3)27-7-2)21-20(22(24)26-5)13-14-23(21)15-17-9-11-18(25-4)12-10-17/h6,9-14H,3,7,15H2,1-2,4-5H3 |
| InChIKey | LBYIUIPQPAEJKW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|