C15H19Cl2N3O3 — CID 8933578
2-[(Z)-[2-(3,4-dichloroanilino)-2-oxoethylidene]amino]oxy-N-[(2R)-3-methylbutan-2-yl]acetamide (PubChem CID 8933578) has the molecular formula C15H19Cl2N3O3 and a molecular weight of 360.24 g/mol. Its IUPAC name is 2-[(Z)-[2-(3,4-dichloroanilino)-2-oxoethylidene]amino]oxy-N-[(2R)-3-methylbutan-2-yl]acetamide.
| Compound Name | 2-[(Z)-[2-(3,4-dichloroanilino)-2-oxoethylidene]amino]oxy-N-[(2R)-3-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 8933578 |
| Molecular Formula | C15H19Cl2N3O3 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-[(Z)-[2-(3,4-dichloroanilino)-2-oxoethylidene]amino]oxy-N-[(2R)-3-methylbutan-2-yl]acetamide |
| SMILES | CC(C)[C@@H](C)NC(=O)CO/N=C\C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2N3O3/c1-9(2)10(3)19-15(22)8-23-18-7-14(21)20-11-4-5-12(16)13(17)6-11/h4-7,9-10H,8H2,1-3H3,(H,19,22)(H,20,21)/b18-7-/t10-/m1/s1 |
| InChIKey | UPTBHNVZVYIFTN-WZHXZVPRSA-N |
| XLogP | 3.10 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|