C31H52O2 — CID 89337034
(1R,6S)-1-[3-[(1R,2R,4aR,8aR)-2,5,5,8a-tetramethyl-6-oxo-1-propyl-1,3,4,4a,7,8-hexahydronaphthalen-2-yl]-3-methylbutyl]-4,6-dimethylcyclohex-3-ene-1-carbaldehyde (PubChem CID 89337034) has the molecular formula C31H52O2 and a molecular weight of 456.76 g/mol. Its IUPAC name is (1R,6S)-1-[3-[(1R,2R,4aR,8aR)-2,5,5,8a-tetramethyl-6-oxo-1-propyl-1,3,4,4a,7,8-hexahydronaphthalen-2-yl]-3-methylbutyl]-4,6-dimethylcyclohex-3-ene-1-carbaldehyde.
| Compound Name | (1R,6S)-1-[3-[(1R,2R,4aR,8aR)-2,5,5,8a-tetramethyl-6-oxo-1-propyl-1,3,4,4a,7,8-hexahydronaphthalen-2-yl]-3-methylbutyl]-4,6-dimethylcyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 89337034 |
| Molecular Formula | C31H52O2 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.40 |
| IUPAC Name | (1R,6S)-1-[3-[(1R,2R,4aR,8aR)-2,5,5,8a-tetramethyl-6-oxo-1-propyl-1,3,4,4a,7,8-hexahydronaphthalen-2-yl]-3-methylbutyl]-4,6-dimethylcyclohex-3-ene-1-carbaldehyde |
| SMILES | CCC[C@@H]1[C@@]2(C)CCC(=O)C(C)(C)[C@@H]2CC[C@@]1(C)C(C)(C)CC[C@@]1(C=O)CC=C(C)C[C@@H]1C |
| InChI | InChI=1S/C31H52O2/c1-10-11-25-29(8)15-14-26(33)28(6,7)24(29)13-16-30(25,9)27(4,5)18-19-31(21-32)17-12-22(2)20-23(31)3/h12,21,23-25H,10-11,13-20H2,1-9H3/t23-,24-,25+,29-,30+,31+/m0/s1 |
| InChIKey | ZCGAEHWHKAVFOD-AGEMNXOTSA-N |
| XLogP | 8.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|