C9H9NO4 — CID 89338685
(2R)-2-amino-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)propanoic acid (PubChem CID 89338685) has the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. Its IUPAC name is (2R)-2-amino-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)propanoic acid |
|---|---|
| PubChem CID | 89338685 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | (2R)-2-amino-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)propanoic acid |
| SMILES | N[C@H](CC1=CC(=O)C(=O)C=C1)C(=O)O |
| InChI | InChI=1S/C9H9NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6H,3,10H2,(H,13,14)/t6-/m1/s1 |
| InChIKey | AHMIDUVKSGCHAU-ZCFIWIBFSA-N |
| XLogP | -0.58 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|