C11H11NO5 — CID 175482378
2-amino-5-(3,4-dioxocyclohexa-1,5-dien-1-yl)-5-oxopentanoic acid (PubChem CID 175482378) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is 2-amino-5-(3,4-dioxocyclohexa-1,5-dien-1-yl)-5-oxopentanoic acid.
| Compound Name | 2-amino-5-(3,4-dioxocyclohexa-1,5-dien-1-yl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175482378 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-amino-5-(3,4-dioxocyclohexa-1,5-dien-1-yl)-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)C1=CC(=O)C(=O)C=C1)C(=O)O |
| InChI | InChI=1S/C11H11NO5/c12-7(11(16)17)2-4-8(13)6-1-3-9(14)10(15)5-6/h1,3,5,7H,2,4,12H2,(H,16,17) |
| InChIKey | OMCOQTUSBCQOQI-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|