C17H30N4O11 — CID 89348087
3-[2-[amino-[(2R)-2,4-dinitrosobutyl]amino]-3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)propoxy]propanoic acid (PubChem CID 89348087) has the molecular formula C17H30N4O11 and a molecular weight of 466.44 g/mol. Its IUPAC name is 3-[2-[amino-[(2R)-2,4-dinitrosobutyl]amino]-3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)propoxy]propanoic acid.
| Compound Name | 3-[2-[amino-[(2R)-2,4-dinitrosobutyl]amino]-3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)propoxy]propanoic acid |
|---|---|
| PubChem CID | 89348087 |
| Molecular Formula | C17H30N4O11 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 3-[2-[amino-[(2R)-2,4-dinitrosobutyl]amino]-3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)propoxy]propanoic acid |
| SMILES | NN(C[C@@H](CCN=O)N=O)C(COCCC(=O)O)(COCCC(=O)O)COCCC(=O)O |
| InChI | InChI=1S/C17H30N4O11/c18-21(9-13(20-29)1-5-19-28)17(10-30-6-2-14(22)23,11-31-7-3-15(24)25)12-32-8-4-16(26)27/h13H,1-12,18H2,(H,22,23)(H,24,25)(H,26,27)/t13-/m1/s1 |
| InChIKey | PCLLDPRUVTWZEE-CYBMUJFWSA-N |
| XLogP | -0.33 |
| TPSA | 227.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|