C17H23ClO5 — CID 89356808
[5-methoxy-4-[3-(3-methylbut-2-enyl)oxiren-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-chloroacetate (PubChem CID 89356808) has the molecular formula C17H23ClO5 and a molecular weight of 342.82 g/mol. Its IUPAC name is [5-methoxy-4-[3-(3-methylbut-2-enyl)oxiren-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-chloroacetate.
| Compound Name | [5-methoxy-4-[3-(3-methylbut-2-enyl)oxiren-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 89356808 |
| Molecular Formula | C17H23ClO5 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [5-methoxy-4-[3-(3-methylbut-2-enyl)oxiren-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-chloroacetate |
| SMILES | COC1C(OC(=O)CCl)CCC2(CO2)C1C1=C(CC=C(C)C)O1 |
| InChI | InChI=1S/C17H23ClO5/c1-10(2)4-5-11-16(23-11)14-15(20-3)12(22-13(19)8-18)6-7-17(14)9-21-17/h4,12,14-15H,5-9H2,1-3H3 |
| InChIKey | RCYCXDMDXIYLOO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|