C30H25N7O12 — CID 89356854
2-[(2Z)-2-[1-[4-[[(2Z)-2-[amino-(2,5-dicarboxyphenyl)hydrazinylidene]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-ylidene]hydrazinyl]terephthalic acid (PubChem CID 89356854) has the molecular formula C30H25N7O12 and a molecular weight of 675.57 g/mol. Its IUPAC name is 2-[(2Z)-2-[1-[4-[[(2Z)-2-[amino-(2,5-dicarboxyphenyl)hydrazinylidene]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-ylidene]hydrazinyl]terephthalic acid.
| Compound Name | 2-[(2Z)-2-[1-[4-[[(2Z)-2-[amino-(2,5-dicarboxyphenyl)hydrazinylidene]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-ylidene]hydrazinyl]terephthalic acid |
|---|---|
| PubChem CID | 89356854 |
| Molecular Formula | C30H25N7O12 |
| Molecular Weight | 675.57 g/mol |
| Exact Mass | 675.16 |
| IUPAC Name | 2-[(2Z)-2-[1-[4-[[(2Z)-2-[amino-(2,5-dicarboxyphenyl)hydrazinylidene]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-ylidene]hydrazinyl]terephthalic acid |
| SMILES | CC(=O)/C(=N/Nc1cc(C(=O)O)ccc1C(=O)O)C(=O)Nc1ccc(NC(=O)/C(=N\N(N)c2cc(C(=O)O)ccc2C(=O)O)C(C)=O)cc1 |
| InChI | InChI=1S/C30H25N7O12/c1-13(38)23(35-34-21-11-15(27(42)43)3-9-19(21)29(46)47)25(40)32-17-5-7-18(8-6-17)33-26(41)24(14(2)39)36-37(31)22-12-16(28(44)45)4-10-20(22)30(48)49/h3-12,34H,31H2,1-2H3,(H,32,40)(H,33,41)(H,42,43)(H,44,45)(H,46,47)(H,48,49)/b35-23-,36-24- |
| InChIKey | LFWXHOYUQBITCD-RXCNPGAZSA-N |
| XLogP | 1.74 |
| TPSA | 307.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|