C33H30N6O12 — CID 88947659
3-[(2Z)-2-[1-[4-[[(2Z)-2-[[2,5-bis(methoxycarbonyl)phenyl]hydrazinylidene]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-ylidene]hydrazinyl]-4-methoxycarbonylbenzoic acid (PubChem CID 88947659) has the molecular formula C33H30N6O12 and a molecular weight of 702.63 g/mol. Its IUPAC name is 3-[(2Z)-2-[1-[4-[[(2Z)-2-[[2,5-bis(methoxycarbonyl)phenyl]hydrazinylidene]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-ylidene]hydrazinyl]-4-methoxycarbonylbenzoic acid.
| Compound Name | 3-[(2Z)-2-[1-[4-[[(2Z)-2-[[2,5-bis(methoxycarbonyl)phenyl]hydrazinylidene]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-ylidene]hydrazinyl]-4-methoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 88947659 |
| Molecular Formula | C33H30N6O12 |
| Molecular Weight | 702.63 g/mol |
| Exact Mass | 702.19 |
| IUPAC Name | 3-[(2Z)-2-[1-[4-[[(2Z)-2-[[2,5-bis(methoxycarbonyl)phenyl]hydrazinylidene]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-ylidene]hydrazinyl]-4-methoxycarbonylbenzoic acid |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(N/N=C(/C(C)=O)C(=O)Nc2ccc(NC(=O)/C(=N\Nc3cc(C(=O)O)ccc3C(=O)OC)C(C)=O)cc2)c1 |
| InChI | InChI=1S/C33H30N6O12/c1-16(40)26(38-36-24-14-18(30(44)45)6-12-22(24)32(47)50-4)28(42)34-20-8-10-21(11-9-20)35-29(43)27(17(2)41)39-37-25-15-19(31(46)49-3)7-13-23(25)33(48)51-5/h6-15,36-37H,1-5H3,(H,34,42)(H,35,43)(H,44,45)/b38-26-,39-27- |
| InChIKey | DNYIYRCQTWFFHG-KOHBJUBXSA-N |
| XLogP | 2.74 |
| TPSA | 257.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.63 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|