C21H21N3O8S — CID 89357611
3-[[(3E)-3-[[2,5-bis(methoxycarbonyl)phenyl]hydrazinylidene]-4-oxopent-1-en-2-yl]amino]benzenesulfonic acid (PubChem CID 89357611) has the molecular formula C21H21N3O8S and a molecular weight of 475.48 g/mol. Its IUPAC name is 3-[[(3E)-3-[[2,5-bis(methoxycarbonyl)phenyl]hydrazinylidene]-4-oxopent-1-en-2-yl]amino]benzenesulfonic acid.
| Compound Name | 3-[[(3E)-3-[[2,5-bis(methoxycarbonyl)phenyl]hydrazinylidene]-4-oxopent-1-en-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 89357611 |
| Molecular Formula | C21H21N3O8S |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 3-[[(3E)-3-[[2,5-bis(methoxycarbonyl)phenyl]hydrazinylidene]-4-oxopent-1-en-2-yl]amino]benzenesulfonic acid |
| SMILES | C=C(Nc1cccc(S(=O)(=O)O)c1)/C(=N\Nc1cc(C(=O)OC)ccc1C(=O)OC)C(C)=O |
| InChI | InChI=1S/C21H21N3O8S/c1-12(22-15-6-5-7-16(11-15)33(28,29)30)19(13(2)25)24-23-18-10-14(20(26)31-3)8-9-17(18)21(27)32-4/h5-11,22-23H,1H2,2-4H3,(H,28,29,30)/b24-19+ |
| InChIKey | AQPOYKKJUXBLSI-LYBHJNIJSA-N |
| XLogP | 2.49 |
| TPSA | 160.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|