C34H31ClN6O12 — CID 73197731
dimethyl 2-[2-[1-[4-[[2-[[2,5-bis(methoxycarbonyl)phenyl]hydrazinylidene]-3-oxobutanoyl]amino]-3-chloroanilino]-1,3-dioxobutan-2-ylidene]hydrazinyl]benzene-1,4-dicarboxylate (PubChem CID 73197731) has the molecular formula C34H31ClN6O12 and a molecular weight of 751.10 g/mol. Its IUPAC name is dimethyl 2-[2-[1-[4-[[2-[[2,5-bis(methoxycarbonyl)phenyl]hydrazinylidene]-3-oxobutanoyl]amino]-3-chloroanilino]-1,3-dioxobutan-2-ylidene]hydrazinyl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[2-[1-[4-[[2-[[2,5-bis(methoxycarbonyl)phenyl]hydrazinylidene]-3-oxobutanoyl]amino]-3-chloroanilino]-1,3-dioxobutan-2-ylidene]hydrazinyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 73197731 |
| Molecular Formula | C34H31ClN6O12 |
| Molecular Weight | 751.10 g/mol |
| Exact Mass | 750.17 |
| IUPAC Name | dimethyl 2-[2-[1-[4-[[2-[[2,5-bis(methoxycarbonyl)phenyl]hydrazinylidene]-3-oxobutanoyl]amino]-3-chloroanilino]-1,3-dioxobutan-2-ylidene]hydrazinyl]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NN=C(C(C)=O)C(=O)Nc2ccc(NC(=O)C(=NNc3cc(C(=O)OC)ccc3C(=O)OC)C(C)=O)c(Cl)c2)c1 |
| InChI | InChI=1S/C34H31ClN6O12/c1-16(42)27(40-38-25-13-18(31(46)50-3)7-10-21(25)33(48)52-5)29(44)36-20-9-12-24(23(35)15-20)37-30(45)28(17(2)43)41-39-26-14-19(32(47)51-4)8-11-22(26)34(49)53-6/h7-15,38-39H,1-6H3,(H,36,44)(H,37,45) |
| InChIKey | DAOWQWHUBNZBNX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 246.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.10 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|