C25H23ClN4 — CID 89357916
1-[2-(2-chlorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]-1-(4-ethyl-4H-naphthalen-1-yl)hydrazine (PubChem CID 89357916) has the molecular formula C25H23ClN4 and a molecular weight of 414.94 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]-1-(4-ethyl-4H-naphthalen-1-yl)hydrazine.
| Compound Name | 1-[2-(2-chlorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]-1-(4-ethyl-4H-naphthalen-1-yl)hydrazine |
|---|---|
| PubChem CID | 89357916 |
| Molecular Formula | C25H23ClN4 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-[2-(2-chlorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]-1-(4-ethyl-4H-naphthalen-1-yl)hydrazine |
| SMILES | CCC1C=C=C(N(N)c2nc(-c3ccccc3Cl)nc3c2CCC3)c2ccccc21 |
| InChI | InChI=1S/C25H23ClN4/c1-2-16-14-15-23(18-9-4-3-8-17(16)18)30(27)25-20-11-7-13-22(20)28-24(29-25)19-10-5-6-12-21(19)26/h3-6,8-10,12,14,16H,2,7,11,13,27H2,1H3 |
| InChIKey | TYTCHZUGRCEUQD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|