C15H27NO — CID 89360665
1-(1-ethyl-3-prop-2-enylpyrrolidin-2-yl)-2,2-dimethylbutan-1-one (PubChem CID 89360665) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-(1-ethyl-3-prop-2-enylpyrrolidin-2-yl)-2,2-dimethylbutan-1-one.
| Compound Name | 1-(1-ethyl-3-prop-2-enylpyrrolidin-2-yl)-2,2-dimethylbutan-1-one |
|---|---|
| PubChem CID | 89360665 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 1-(1-ethyl-3-prop-2-enylpyrrolidin-2-yl)-2,2-dimethylbutan-1-one |
| SMILES | C=CCC1CCN(CC)C1C(=O)C(C)(C)CC |
| InChI | InChI=1S/C15H27NO/c1-6-9-12-10-11-16(8-3)13(12)14(17)15(4,5)7-2/h6,12-13H,1,7-11H2,2-5H3 |
| InChIKey | RCWRPJUWKZJRAI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|