C10H19N3O — CID 89360708
1-(5-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrazol-4-yl)propan-1-one (PubChem CID 89360708) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-(5-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrazol-4-yl)propan-1-one.
| Compound Name | 1-(5-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 89360708 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-(5-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrazol-4-yl)propan-1-one |
| SMILES | CCC(=O)C1C2CNNC2CN1CC |
| InChI | InChI=1S/C10H19N3O/c1-3-9(14)10-7-5-11-12-8(7)6-13(10)4-2/h7-8,10-12H,3-6H2,1-2H3 |
| InChIKey | UAYYWGINMRKQNH-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |