C22H22N4O3S2 — CID 89362474
5-[(E)-2-(4-nitrophenyl)ethenyl]-N-(4-piperidin-4-ylsulfinylphenyl)-1,3-thiazol-2-amine (PubChem CID 89362474) has the molecular formula C22H22N4O3S2 and a molecular weight of 454.58 g/mol. Its IUPAC name is 5-[(E)-2-(4-nitrophenyl)ethenyl]-N-(4-piperidin-4-ylsulfinylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-[(E)-2-(4-nitrophenyl)ethenyl]-N-(4-piperidin-4-ylsulfinylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 89362474 |
| Molecular Formula | C22H22N4O3S2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 5-[(E)-2-(4-nitrophenyl)ethenyl]-N-(4-piperidin-4-ylsulfinylphenyl)-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2cnc(Nc3ccc(S(=O)C4CCNCC4)cc3)s2)cc1 |
| InChI | InChI=1S/C22H22N4O3S2/c27-26(28)18-6-1-16(2-7-18)3-8-19-15-24-22(30-19)25-17-4-9-20(10-5-17)31(29)21-11-13-23-14-12-21/h1-10,15,21,23H,11-14H2,(H,24,25)/b8-3+ |
| InChIKey | WCDNQYXDEAQFBT-FPYGCLRLSA-N |
| XLogP | 4.82 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|