C22H27N3O4 — CID 8936732
[2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate (PubChem CID 8936732) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate.
| Compound Name | [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 8936732 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate |
| SMILES | CC[C@@H](C)c1ccc(NC(=O)COC(=O)[C@H](Cc2ccccc2)NC(N)=O)cc1 |
| InChI | InChI=1S/C22H27N3O4/c1-3-15(2)17-9-11-18(12-10-17)24-20(26)14-29-21(27)19(25-22(23)28)13-16-7-5-4-6-8-16/h4-12,15,19H,3,13-14H2,1-2H3,(H,24,26)(H3,23,25,28)/t15-,19+/m1/s1 |
| InChIKey | MFYNJACQRWUYCJ-BEFAXECRSA-N |
| XLogP | 2.96 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |