C20H23N3O4S — CID 8938683
[2-oxo-2-(2-phenylsulfanylethylamino)ethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate (PubChem CID 8938683) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 8938683 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate |
| SMILES | NC(=O)N[C@@H](Cc1ccccc1)C(=O)OCC(=O)NCCSc1ccccc1 |
| InChI | InChI=1S/C20H23N3O4S/c21-20(26)23-17(13-15-7-3-1-4-8-15)19(25)27-14-18(24)22-11-12-28-16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H,22,24)(H3,21,23,26)/t17-/m0/s1 |
| InChIKey | TTZGBWSXLVESEH-KRWDZBQOSA-N |
| XLogP | 1.72 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|