C21H25N3O4 — CID 8938266
[2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate (PubChem CID 8938266) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate.
| Compound Name | [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 8938266 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate |
| SMILES | C[C@H](CNC(=O)COC(=O)[C@H](Cc1ccccc1)NC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O4/c1-15(17-10-6-3-7-11-17)13-23-19(25)14-28-20(26)18(24-21(22)27)12-16-8-4-2-5-9-16/h2-11,15,18H,12-14H2,1H3,(H,23,25)(H3,22,24,27)/t15-,18+/m1/s1 |
| InChIKey | UOTQCUSOMNCTFB-QAPCUYQASA-N |
| XLogP | 1.73 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |