C11H22O8P2 — CID 89367393
[7-[3-[hydroxy(methyl)phosphoryl]propanoyloxy]-3-oxoheptyl]phosphonic acid (PubChem CID 89367393) has the molecular formula C11H22O8P2 and a molecular weight of 344.24 g/mol. Its IUPAC name is [7-[3-[hydroxy(methyl)phosphoryl]propanoyloxy]-3-oxoheptyl]phosphonic acid.
| Compound Name | [7-[3-[hydroxy(methyl)phosphoryl]propanoyloxy]-3-oxoheptyl]phosphonic acid |
|---|---|
| PubChem CID | 89367393 |
| Molecular Formula | C11H22O8P2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | [7-[3-[hydroxy(methyl)phosphoryl]propanoyloxy]-3-oxoheptyl]phosphonic acid |
| SMILES | CP(=O)(O)CCC(=O)OCCCCC(=O)CCP(=O)(O)O |
| InChI | InChI=1S/C11H22O8P2/c1-20(14,15)8-6-11(13)19-7-3-2-4-10(12)5-9-21(16,17)18/h2-9H2,1H3,(H,14,15)(H2,16,17,18) |
| InChIKey | XIHVBTLXZXIPQT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|