C22H19NO5 — CID 89367452
8-acetyl-3-(3,4-dihydropyridin-3-ylmethoxy)-2-methoxybenzo[c]chromen-6-one (PubChem CID 89367452) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 8-acetyl-3-(3,4-dihydropyridin-3-ylmethoxy)-2-methoxybenzo[c]chromen-6-one.
| Compound Name | 8-acetyl-3-(3,4-dihydropyridin-3-ylmethoxy)-2-methoxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 89367452 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 8-acetyl-3-(3,4-dihydropyridin-3-ylmethoxy)-2-methoxybenzo[c]chromen-6-one |
| SMILES | COc1cc2c(cc1OCC1C=NC=CC1)oc(=O)c1cc(C(C)=O)ccc12 |
| InChI | InChI=1S/C22H19NO5/c1-13(24)15-5-6-16-17-9-20(26-2)21(27-12-14-4-3-7-23-11-14)10-19(17)28-22(25)18(16)8-15/h3,5-11,14H,4,12H2,1-2H3 |
| InChIKey | XEGPMGDTKYODLR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|