C25H31ClN6O3 — CID 89371715
tert-butyl N-[5-[2-amino-4-chloro-7-[(5-methoxy-4,6-dimethyl-3-pyridinyl)methyl]pyrrolo[2,3-d]pyrimidin-5-yl]pent-4-ynyl]carbamate (PubChem CID 89371715) has the molecular formula C25H31ClN6O3 and a molecular weight of 499.02 g/mol. Its IUPAC name is tert-butyl N-[5-[2-amino-4-chloro-7-[(5-methoxy-4,6-dimethyl-3-pyridinyl)methyl]pyrrolo[2,3-d]pyrimidin-5-yl]pent-4-ynyl]carbamate.
| Compound Name | tert-butyl N-[5-[2-amino-4-chloro-7-[(5-methoxy-4,6-dimethyl-3-pyridinyl)methyl]pyrrolo[2,3-d]pyrimidin-5-yl]pent-4-ynyl]carbamate |
|---|---|
| PubChem CID | 89371715 |
| Molecular Formula | C25H31ClN6O3 |
| Molecular Weight | 499.02 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | tert-butyl N-[5-[2-amino-4-chloro-7-[(5-methoxy-4,6-dimethyl-3-pyridinyl)methyl]pyrrolo[2,3-d]pyrimidin-5-yl]pent-4-ynyl]carbamate |
| SMILES | COc1c(C)ncc(Cn2cc(C#CCCCNC(=O)OC(C)(C)C)c3c(Cl)nc(N)nc32)c1C |
| InChI | InChI=1S/C25H31ClN6O3/c1-15-18(12-29-16(2)20(15)34-6)14-32-13-17(19-21(26)30-23(27)31-22(19)32)10-8-7-9-11-28-24(33)35-25(3,4)5/h12-13H,7,9,11,14H2,1-6H3,(H,28,33)(H2,27,30,31) |
| InChIKey | MVJCTCDPEUUGPC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.02 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|