C29H42O2 — CID 89372351
(13S,17S)-3,17-dibutoxy-13-methyl-11-prop-2-enyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene (PubChem CID 89372351) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is (13S,17S)-3,17-dibutoxy-13-methyl-11-prop-2-enyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene.
| Compound Name | (13S,17S)-3,17-dibutoxy-13-methyl-11-prop-2-enyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 89372351 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | (13S,17S)-3,17-dibutoxy-13-methyl-11-prop-2-enyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene |
| SMILES | C=CCC1=C2c3ccc(OCCCC)cc3CCC2C2CC[C@H](OCCCC)[C@@]2(C)C1 |
| InChI | InChI=1S/C29H42O2/c1-5-8-17-30-23-12-14-24-21(19-23)11-13-25-26-15-16-27(31-18-9-6-2)29(26,4)20-22(10-7-3)28(24)25/h7,12,14,19,25-27H,3,5-6,8-11,13,15-18,20H2,1-2,4H3/t25?,26?,27-,29-/m0/s1 |
| InChIKey | PVXOQVNYHYRKEG-XELBMSLBSA-N |
| XLogP | 7.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|