C48H62O4 — CID 71205171
ethyl 11-[(13S,17S)-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-11-yl]-2-propylundec-9-enoate (PubChem CID 71205171) has the molecular formula C48H62O4 and a molecular weight of 703.02 g/mol. Its IUPAC name is ethyl 11-[(13S,17S)-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-11-yl]-2-propylundec-9-enoate.
| Compound Name | ethyl 11-[(13S,17S)-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-11-yl]-2-propylundec-9-enoate |
|---|---|
| PubChem CID | 71205171 |
| Molecular Formula | C48H62O4 |
| Molecular Weight | 703.02 g/mol |
| Exact Mass | 702.46 |
| IUPAC Name | ethyl 11-[(13S,17S)-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-11-yl]-2-propylundec-9-enoate |
| SMILES | CCCC(CCCCCCC=CCC1=C2c3ccc(OCc4ccccc4)cc3CCC2C2CC[C@H](OCc3ccccc3)[C@@]2(C)C1)C(=O)OCC |
| InChI | InChI=1S/C48H62O4/c1-4-19-38(47(49)50-5-2)24-17-9-7-6-8-10-18-25-40-33-48(3)44(30-31-45(48)52-35-37-22-15-12-16-23-37)43-28-26-39-32-41(27-29-42(39)46(40)43)51-34-36-20-13-11-14-21-36/h10-16,18,20-23,27,29,32,38,43-45H,4-9,17,19,24-26,28,30-31,33-35H2,1-3H3/t38?,43?,44?,45-,48-/m0/s1 |
| InChIKey | GXGVBYPCHWGGIY-QOVXULMSSA-N |
| XLogP | 12.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.02 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|