C27H51N — CID 89374759
(4S,5Z)-3-ethyl-4-methyl-N-[(3E,5S)-2,2,5-trimethyl-3-propylideneheptyl]undeca-5,10-dien-1-amine (PubChem CID 89374759) has the molecular formula C27H51N and a molecular weight of 389.71 g/mol. Its IUPAC name is (4S,5Z)-3-ethyl-4-methyl-N-[(3E,5S)-2,2,5-trimethyl-3-propylideneheptyl]undeca-5,10-dien-1-amine.
| Compound Name | (4S,5Z)-3-ethyl-4-methyl-N-[(3E,5S)-2,2,5-trimethyl-3-propylideneheptyl]undeca-5,10-dien-1-amine |
|---|---|
| PubChem CID | 89374759 |
| Molecular Formula | C27H51N |
| Molecular Weight | 389.71 g/mol |
| Exact Mass | 389.40 |
| IUPAC Name | (4S,5Z)-3-ethyl-4-methyl-N-[(3E,5S)-2,2,5-trimethyl-3-propylideneheptyl]undeca-5,10-dien-1-amine |
| SMILES | C=CCCC/C=C\[C@@H](C)C(CC)CCNCC(C)(C)/C(=C/CC)C[C@@H](C)CC |
| InChI | InChI=1S/C27H51N/c1-9-13-14-15-16-18-24(6)25(12-4)19-20-28-22-27(7,8)26(17-10-2)21-23(5)11-3/h9,16-18,23-25,28H,1,10-15,19-22H2,2-8H3/b18-16-,26-17+/t23-,24+,25?/m0/s1 |
| InChIKey | HMNSXJFMCQWORM-QMKLMHNBSA-N |
| XLogP | 8.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.71 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|