C10H14F3NO2 — CID 89375114
2-ethoxy-4-nitroso-4-(trifluoromethyl)hepta-1,6-diene (PubChem CID 89375114) has the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. Its IUPAC name is 2-ethoxy-4-nitroso-4-(trifluoromethyl)hepta-1,6-diene.
| Compound Name | 2-ethoxy-4-nitroso-4-(trifluoromethyl)hepta-1,6-diene |
|---|---|
| PubChem CID | 89375114 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-ethoxy-4-nitroso-4-(trifluoromethyl)hepta-1,6-diene |
| SMILES | C=CCC(CC(=C)OCC)(N=O)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO2/c1-4-6-9(14-15,10(11,12)13)7-8(3)16-5-2/h4H,1,3,5-7H2,2H3 |
| InChIKey | VKJMWYPSYQMATL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|