C10H15F3O2 — CID 89119634
2-ethoxy-4-(trifluoromethyl)hepta-1,6-dien-4-ol (PubChem CID 89119634) has the molecular formula C10H15F3O2 and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-ethoxy-4-(trifluoromethyl)hepta-1,6-dien-4-ol.
| Compound Name | 2-ethoxy-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 89119634 |
| Molecular Formula | C10H15F3O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-ethoxy-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
| SMILES | C=CCC(O)(CC(=C)OCC)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O2/c1-4-6-9(14,10(11,12)13)7-8(3)15-5-2/h4,14H,1,3,5-7H2,2H3 |
| InChIKey | RSTOZSQXGZJBJW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|