About 1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine
1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine (PubChem CID 89383797) has the molecular formula C8H6N4S
and a molecular weight of 190.23 g/mol. Its IUPAC name is 1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine.
Molecular Properties
| Compound Name | 1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine |
| PubChem CID | 89383797 |
| Molecular Formula | C8H6N4S |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine |
| SMILES | Nc1n[nH]c2cc3ncsc3cc12 |
| InChI | InChI=1S/C8H6N4S/c9-8-4-1-7-6(10-3-13-7)2-5(4)11-12-8/h1-3H,(H3,9,11,12) |
| InChIKey | BEPQQFUIWLOPBJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine?
The IUPAC name of 1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine (CID 89383797) is 1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine.
What is the SMILES notation for 1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine?
The canonical SMILES for 1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine is Nc1n[nH]c2cc3ncsc3cc12.
What is the InChIKey of 1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine?
The InChIKey is BEPQQFUIWLOPBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4S/c9-8-4-1-7-6(10-3-13-7)2-5(4)11-12-8/h1-3H,(H3,9,11,12).
What are the key properties of 1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine?
1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine has a molecular weight of 190.23 g/mol, XLogP of 1.75, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazolo[3,4-f][1,3]benzothiazol-3-amine is sourced from PubChem (CID 89383797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).