C18H26N2O8S2 — CID 89385267
(3-acetyl-2,5,5-trimethyl-1,3-thiazolidine-4-carbonyl)oxymethyl 3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 89385267) has the molecular formula C18H26N2O8S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is (3-acetyl-2,5,5-trimethyl-1,3-thiazolidine-4-carbonyl)oxymethyl 3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (3-acetyl-2,5,5-trimethyl-1,3-thiazolidine-4-carbonyl)oxymethyl 3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 89385267 |
| Molecular Formula | C18H26N2O8S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | (3-acetyl-2,5,5-trimethyl-1,3-thiazolidine-4-carbonyl)oxymethyl 3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(=O)N1C(C)SC(C)(C)C1C(=O)OCOC(=O)C1N2C(=O)CC2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C18H26N2O8S2/c1-9(21)19-10(2)29-17(3,4)13(19)15(23)27-8-28-16(24)14-18(5,6)30(25,26)12-7-11(22)20(12)14/h10,12-14H,7-8H2,1-6H3 |
| InChIKey | DIGHPYJYNGXUJQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|