C24H26IN5O2 — CID 89387226
2-[[4-(N,N-dimethylcarbamimidoyl)phenyl]methylamino]-N-[5-(iodomethyl)-2-pyridinyl]-5-methoxybenzamide (PubChem CID 89387226) has the molecular formula C24H26IN5O2 and a molecular weight of 543.41 g/mol. Its IUPAC name is 2-[[4-(N,N-dimethylcarbamimidoyl)phenyl]methylamino]-N-[5-(iodomethyl)-2-pyridinyl]-5-methoxybenzamide.
| Compound Name | 2-[[4-(N,N-dimethylcarbamimidoyl)phenyl]methylamino]-N-[5-(iodomethyl)-2-pyridinyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 89387226 |
| Molecular Formula | C24H26IN5O2 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 2-[[4-(N,N-dimethylcarbamimidoyl)phenyl]methylamino]-N-[5-(iodomethyl)-2-pyridinyl]-5-methoxybenzamide |
| SMILES | [H]/N=C(/c1ccc(CNc2ccc(OC)cc2C(=O)Nc2ccc(CI)cn2)cc1)N(C)C |
| InChI | InChI=1S/C24H26IN5O2/c1-30(2)23(26)18-7-4-16(5-8-18)14-27-21-10-9-19(32-3)12-20(21)24(31)29-22-11-6-17(13-25)15-28-22/h4-12,15,26-27H,13-14H2,1-3H3,(H,28,29,31)/b26-23- |
| InChIKey | QWNFJVJFSAFZBU-RWEWTDSWSA-N |
| XLogP | 4.78 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|