C16H28N4O2+2 — CID 89394666
N-[2-[4-[2-(prop-2-enoylamino)ethyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]prop-2-enamide (PubChem CID 89394666) has the molecular formula C16H28N4O2+2 and a molecular weight of 308.43 g/mol. Its IUPAC name is N-[2-[4-[2-(prop-2-enoylamino)ethyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]prop-2-enamide.
| Compound Name | N-[2-[4-[2-(prop-2-enoylamino)ethyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 89394666 |
| Molecular Formula | C16H28N4O2+2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | N-[2-[4-[2-(prop-2-enoylamino)ethyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC[N+]12CC[N+](CCNC(=O)C=C)(CC1)CC2 |
| InChI | InChI=1S/C16H26N4O2/c1-3-15(21)17-5-7-19-9-12-20(13-10-19,14-11-19)8-6-18-16(22)4-2/h3-4H,1-2,5-14H2/p+2 |
| InChIKey | CPMTUOGSYDAEKC-UHFFFAOYSA-P |
| XLogP | -0.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|