C28H36IN5O5 — CID 89406351
7-[(2R)-3-(diethylamino)-2-hydroxypropoxy]-N-ethyl-4-[3-(iodomethyl)-4-(methylcarbamoylamino)phenoxy]quinoline-6-carboxamide (PubChem CID 89406351) has the molecular formula C28H36IN5O5 and a molecular weight of 649.53 g/mol. Its IUPAC name is 7-[(2R)-3-(diethylamino)-2-hydroxypropoxy]-N-ethyl-4-[3-(iodomethyl)-4-(methylcarbamoylamino)phenoxy]quinoline-6-carboxamide.
| Compound Name | 7-[(2R)-3-(diethylamino)-2-hydroxypropoxy]-N-ethyl-4-[3-(iodomethyl)-4-(methylcarbamoylamino)phenoxy]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 89406351 |
| Molecular Formula | C28H36IN5O5 |
| Molecular Weight | 649.53 g/mol |
| Exact Mass | 649.18 |
| IUPAC Name | 7-[(2R)-3-(diethylamino)-2-hydroxypropoxy]-N-ethyl-4-[3-(iodomethyl)-4-(methylcarbamoylamino)phenoxy]quinoline-6-carboxamide |
| SMILES | CCNC(=O)c1cc2c(Oc3ccc(NC(=O)NC)c(CI)c3)ccnc2cc1OC[C@H](O)CN(CC)CC |
| InChI | InChI=1S/C28H36IN5O5/c1-5-31-27(36)22-13-21-24(14-26(22)38-17-19(35)16-34(6-2)7-3)32-11-10-25(21)39-20-8-9-23(18(12-20)15-29)33-28(37)30-4/h8-14,19,35H,5-7,15-17H2,1-4H3,(H,31,36)(H2,30,33,37)/t19-/m1/s1 |
| InChIKey | JJGYBEKMGQOBIG-LJQANCHMSA-N |
| XLogP | 4.54 |
| TPSA | 125.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|