C21H41N5O2 — CID 89407634
N-[3-(dimethylamino)propyl]formamide;2,3,4-tris[(dimethylamino)methyl]phenol (PubChem CID 89407634) has the molecular formula C21H41N5O2 and a molecular weight of 395.59 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]formamide;2,3,4-tris[(dimethylamino)methyl]phenol.
| Compound Name | N-[3-(dimethylamino)propyl]formamide;2,3,4-tris[(dimethylamino)methyl]phenol |
|---|---|
| PubChem CID | 89407634 |
| Molecular Formula | C21H41N5O2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.33 |
| IUPAC Name | N-[3-(dimethylamino)propyl]formamide;2,3,4-tris[(dimethylamino)methyl]phenol |
| SMILES | CN(C)CCCNC=O.CN(C)Cc1ccc(O)c(CN(C)C)c1CN(C)C |
| InChI | InChI=1S/C15H27N3O.C6H14N2O/c1-16(2)9-12-7-8-15(19)14(11-18(5)6)13(12)10-17(3)4;1-8(2)5-3-4-7-6-9/h7-8,19H,9-11H2,1-6H3;6H,3-5H2,1-2H3,(H,7,9) |
| InChIKey | PDXSSKWEMYOAOG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|