C20H23N3O6 — CID 89413216
N'-hydroxy-2-[[4-[4-(2-hydroxyethoxy)phenyl]benzoyl]amino]-N,N-dimethylpropanediamide (PubChem CID 89413216) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is N'-hydroxy-2-[[4-[4-(2-hydroxyethoxy)phenyl]benzoyl]amino]-N,N-dimethylpropanediamide.
| Compound Name | N'-hydroxy-2-[[4-[4-(2-hydroxyethoxy)phenyl]benzoyl]amino]-N,N-dimethylpropanediamide |
|---|---|
| PubChem CID | 89413216 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N'-hydroxy-2-[[4-[4-(2-hydroxyethoxy)phenyl]benzoyl]amino]-N,N-dimethylpropanediamide |
| SMILES | CN(C)C(=O)C(NC(=O)c1ccc(-c2ccc(OCCO)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C20H23N3O6/c1-23(2)20(27)17(19(26)22-28)21-18(25)15-5-3-13(4-6-15)14-7-9-16(10-8-14)29-12-11-24/h3-10,17,24,28H,11-12H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | NPSKLZIHDFBXSW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|