C21H24N4O5 — CID 89416354
2-[[4-[4-[3-(dimethylamino)-3-oxopropyl]phenyl]benzoyl]amino]-N'-hydroxypropanediamide (PubChem CID 89416354) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-[[4-[4-[3-(dimethylamino)-3-oxopropyl]phenyl]benzoyl]amino]-N'-hydroxypropanediamide.
| Compound Name | 2-[[4-[4-[3-(dimethylamino)-3-oxopropyl]phenyl]benzoyl]amino]-N'-hydroxypropanediamide |
|---|---|
| PubChem CID | 89416354 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-[[4-[4-[3-(dimethylamino)-3-oxopropyl]phenyl]benzoyl]amino]-N'-hydroxypropanediamide |
| SMILES | CN(C)C(=O)CCc1ccc(-c2ccc(C(=O)NC(C(N)=O)C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C21H24N4O5/c1-25(2)17(26)12-5-13-3-6-14(7-4-13)15-8-10-16(11-9-15)20(28)23-18(19(22)27)21(29)24-30/h3-4,6-11,18,30H,5,12H2,1-2H3,(H2,22,27)(H,23,28)(H,24,29) |
| InChIKey | SJIGBEFUCVUTNX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|