C13H18N4O2S2 — CID 89413667
carbamothioic S-acid;2-cyanoethyl-[(4,6-dimethyl-3-pyridinyl)methyl]carbamothioic S-acid (PubChem CID 89413667) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is carbamothioic S-acid;2-cyanoethyl-[(4,6-dimethyl-3-pyridinyl)methyl]carbamothioic S-acid.
| Compound Name | carbamothioic S-acid;2-cyanoethyl-[(4,6-dimethyl-3-pyridinyl)methyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 89413667 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | carbamothioic S-acid;2-cyanoethyl-[(4,6-dimethyl-3-pyridinyl)methyl]carbamothioic S-acid |
| SMILES | Cc1cc(C)c(CN(CCC#N)C(=O)S)cn1.NC(=O)S |
| InChI | InChI=1S/C12H15N3OS.CH3NOS/c1-9-6-10(2)14-7-11(9)8-15(12(16)17)5-3-4-13;2-1(3)4/h6-7H,3,5,8H2,1-2H3,(H,16,17);(H3,2,3,4) |
| InChIKey | XZVLHZZXWWRMDB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|