About 2-fluoroethyl 2-methylperoxy-2-oxoacetate
2-fluoroethyl 2-methylperoxy-2-oxoacetate (PubChem CID 89415484) has the molecular formula C5H7FO5
and a molecular weight of 166.10 g/mol. Its IUPAC name is 2-fluoroethyl 2-methylperoxy-2-oxoacetate.
Molecular Properties
| Compound Name | 2-fluoroethyl 2-methylperoxy-2-oxoacetate |
| PubChem CID | 89415484 |
| Molecular Formula | C5H7FO5 |
| Molecular Weight | 166.10 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 2-fluoroethyl 2-methylperoxy-2-oxoacetate |
| SMILES | COOC(=O)C(=O)OCCF |
| InChI | InChI=1S/C5H7FO5/c1-9-11-5(8)4(7)10-3-2-6/h2-3H2,1H3 |
| InChIKey | CFDITJYNIGWPQB-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.10 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroethyl 2-methylperoxy-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl 2-methylperoxy-2-oxoacetate?
The IUPAC name of 2-fluoroethyl 2-methylperoxy-2-oxoacetate (CID 89415484) is 2-fluoroethyl 2-methylperoxy-2-oxoacetate.
What is the SMILES notation for 2-fluoroethyl 2-methylperoxy-2-oxoacetate?
The canonical SMILES for 2-fluoroethyl 2-methylperoxy-2-oxoacetate is COOC(=O)C(=O)OCCF.
What is the InChIKey of 2-fluoroethyl 2-methylperoxy-2-oxoacetate?
The InChIKey is CFDITJYNIGWPQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FO5/c1-9-11-5(8)4(7)10-3-2-6/h2-3H2,1H3.
What are the key properties of 2-fluoroethyl 2-methylperoxy-2-oxoacetate?
2-fluoroethyl 2-methylperoxy-2-oxoacetate has a molecular weight of 166.10 g/mol, XLogP of -0.40, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl 2-methylperoxy-2-oxoacetate is sourced from PubChem (CID 89415484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).