C12H12ClNO4S2 — CID 894168
5-chloro-N-(3,4-dimethoxyphenyl)thiophene-2-sulfonamide (PubChem CID 894168) has the molecular formula C12H12ClNO4S2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 5-chloro-N-(3,4-dimethoxyphenyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(3,4-dimethoxyphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 894168 |
| Molecular Formula | C12H12ClNO4S2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 5-chloro-N-(3,4-dimethoxyphenyl)thiophene-2-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(Cl)s2)cc1OC |
| InChI | InChI=1S/C12H12ClNO4S2/c1-17-9-4-3-8(7-10(9)18-2)14-20(15,16)12-6-5-11(13)19-12/h3-7,14H,1-2H3 |
| InChIKey | HEQILIHBMVATFY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |