C21H24BN3O2S — CID 89423164
N-(6-methyl-2-pyridinyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazol-2-amine (PubChem CID 89423164) has the molecular formula C21H24BN3O2S and a molecular weight of 393.32 g/mol. Its IUPAC name is N-(6-methyl-2-pyridinyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | N-(6-methyl-2-pyridinyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 89423164 |
| Molecular Formula | C21H24BN3O2S |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-(6-methyl-2-pyridinyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazol-2-amine |
| SMILES | Cc1cccc(Nc2nc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cs2)n1 |
| InChI | InChI=1S/C21H24BN3O2S/c1-14-7-6-8-18(23-14)25-19-24-17(13-28-19)15-9-11-16(12-10-15)22-26-20(2,3)21(4,5)27-22/h6-13H,1-5H3,(H,23,24,25) |
| InChIKey | NEXUOSJHWSIGNJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|