About N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide
N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide (PubChem CID 89424443) has the molecular formula C9H19NO6
and a molecular weight of 237.25 g/mol. Its IUPAC name is N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide |
| PubChem CID | 89424443 |
| Molecular Formula | C9H19NO6 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide |
| SMILES | COCC(O)C(NC(C)=O)[C@H](O)OCCO |
| InChI | InChI=1S/C9H19NO6/c1-6(12)10-8(7(13)5-15-2)9(14)16-4-3-11/h7-9,11,13-14H,3-5H2,1-2H3,(H,10,12)/t7?,8?,9-/m1/s1 |
| InChIKey | NRBGDMDUTHRARD-AMDVSUOASA-N |
| XLogP | -2.17 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide?
The IUPAC name of N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide (CID 89424443) is N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide.
What is the SMILES notation for N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide?
The canonical SMILES for N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide is COCC(O)C(NC(C)=O)[C@H](O)OCCO.
What is the InChIKey of N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide?
The InChIKey is NRBGDMDUTHRARD-AMDVSUOASA-N. The full InChI is InChI=1S/C9H19NO6/c1-6(12)10-8(7(13)5-15-2)9(14)16-4-3-11/h7-9,11,13-14H,3-5H2,1-2H3,(H,10,12)/t7?,8?,9-/m1/s1.
What are the key properties of N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide?
N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide has a molecular weight of 237.25 g/mol, XLogP of -2.17, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1,3-dihydroxy-1-(2-hydroxyethoxy)-4-methoxybutan-2-yl]acetamide is sourced from PubChem (CID 89424443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).