C10H18ClF3N2O4 — CID 89428143
[tert-butyl-[2-(methylamino)ethoxycarbonyl]amino] 2,2,2-trifluoroacetate;hydrochloride (PubChem CID 89428143) has the molecular formula C10H18ClF3N2O4 and a molecular weight of 322.71 g/mol. Its IUPAC name is [tert-butyl-[2-(methylamino)ethoxycarbonyl]amino] 2,2,2-trifluoroacetate;hydrochloride.
| Compound Name | [tert-butyl-[2-(methylamino)ethoxycarbonyl]amino] 2,2,2-trifluoroacetate;hydrochloride |
|---|---|
| PubChem CID | 89428143 |
| Molecular Formula | C10H18ClF3N2O4 |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [tert-butyl-[2-(methylamino)ethoxycarbonyl]amino] 2,2,2-trifluoroacetate;hydrochloride |
| SMILES | CNCCOC(=O)N(OC(=O)C(F)(F)F)C(C)(C)C.Cl |
| InChI | InChI=1S/C10H17F3N2O4.ClH/c1-9(2,3)15(8(17)18-6-5-14-4)19-7(16)10(11,12)13;/h14H,5-6H2,1-4H3;1H |
| InChIKey | OSHYBEIYFXFUAH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|