C13H20N2O6S2 — CID 8943493
[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate (PubChem CID 8943493) has the molecular formula C13H20N2O6S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate.
| Compound Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate |
|---|---|
| PubChem CID | 8943493 |
| Molecular Formula | C13H20N2O6S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate |
| SMILES | COCCNC(=O)[C@H](C)OC(=O)CN(C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H20N2O6S2/c1-10(13(17)14-6-7-20-3)21-11(16)9-15(2)23(18,19)12-5-4-8-22-12/h4-5,8,10H,6-7,9H2,1-3H3,(H,14,17)/t10-/m0/s1 |
| InChIKey | QLRSCHMUBNGJII-JTQLQIEISA-N |
| XLogP | 0.06 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|