C20H20ClF3N4O5 — CID 89437214
[(2R)-3-(2-chloro-4-nitroimidazol-2-yl)-2-hydroxy-2-methylpropyl] 4-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 89437214) has the molecular formula C20H20ClF3N4O5 and a molecular weight of 488.85 g/mol. Its IUPAC name is [(2R)-3-(2-chloro-4-nitroimidazol-2-yl)-2-hydroxy-2-methylpropyl] 4-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | [(2R)-3-(2-chloro-4-nitroimidazol-2-yl)-2-hydroxy-2-methylpropyl] 4-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 89437214 |
| Molecular Formula | C20H20ClF3N4O5 |
| Molecular Weight | 488.85 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | [(2R)-3-(2-chloro-4-nitroimidazol-2-yl)-2-hydroxy-2-methylpropyl] 4-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C[C@](O)(COC(=O)N1CC=C(c2ccc(C(F)(F)F)cc2)CC1)CC1(Cl)N=CC([N+](=O)[O-])=N1 |
| InChI | InChI=1S/C20H20ClF3N4O5/c1-18(30,11-19(21)25-10-16(26-19)28(31)32)12-33-17(29)27-8-6-14(7-9-27)13-2-4-15(5-3-13)20(22,23)24/h2-6,10,30H,7-9,11-12H2,1H3/t18-,19?/m1/s1 |
| InChIKey | GRJDVUKJMSWMQH-MRTLOADZSA-N |
| XLogP | 3.72 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.85 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|