C16H24O6 — CID 89438667
2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-trien-3-yl)ethanol (PubChem CID 89438667) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-trien-3-yl)ethanol.
| Compound Name | 2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-trien-3-yl)ethanol |
|---|---|
| PubChem CID | 89438667 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-trien-3-yl)ethanol |
| SMILES | OCCC1COCCOCCOCCOc2ccccc2O1 |
| InChI | InChI=1S/C16H24O6/c17-6-5-14-13-20-10-9-18-7-8-19-11-12-21-15-3-1-2-4-16(15)22-14/h1-4,14,17H,5-13H2 |
| InChIKey | PXDRZEZBRJDKFA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |